Information card for entry 1503280
| Formula |
C25 H16 N6 |
| Calculated formula |
C25 H16 N6 |
| SMILES |
[nH]1c(nc2nc(nc3nc(nc1c23)c1ccccc1)c1ccccc1)c1ccccc1 |
| Title of publication |
Hexaazaphenalene derivatives: one-pot synthesis, hydrogen-bonded chiral helix, and fluorescence properties. |
| Authors of publication |
Suzuki, Shuichi; Fukui, Kozo; Fuyuhiro, Akira; Sato, Kazunobu; Takui, Takeji; Nakasuji, Kazuhiro; Morita, Yasushi |
| Journal of publication |
Organic letters |
| Year of publication |
2010 |
| Journal volume |
12 |
| Journal issue |
21 |
| Pages of publication |
5036 - 5039 |
| a |
9.588 ± 0.004 Å |
| b |
18.682 ± 0.009 Å |
| c |
11.326 ± 0.007 Å |
| α |
90° |
| β |
108.987 ± 0.019° |
| γ |
90° |
| Cell volume |
1918.4 ± 1.7 Å3 |
| Cell temperature |
200.1 K |
| Ambient diffraction temperature |
200.1 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for significantly intense reflections |
0.0377 |
| Weighted residual factors for all reflections included in the refinement |
0.109 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.067 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1503280.html