Information card for entry 1506014
| Common name |
compound 11e |
| Chemical name |
5,17,25,27-tetraaza-11,23-dimethyl-2,8,14,20-tetraoxacalix[4]arene |
| Formula |
C22 H16 N4 O4 |
| Calculated formula |
C22 H16 N4 O4 |
| SMILES |
c12cncc(n1)Oc1cc(cc(c1)Oc1cncc(n1)Oc1cc(cc(c1)O2)C)C |
| Title of publication |
Synthesis of oxacalixarenes incorporating nitrogen heterocycles: evidence for thermodynamic control. |
| Authors of publication |
Katz, Jeffrey L.; Geller, Bram J.; Conry, Rebecca R. |
| Journal of publication |
Organic letters |
| Year of publication |
2006 |
| Journal volume |
8 |
| Journal issue |
13 |
| Pages of publication |
2755 - 2758 |
| a |
15.6963 ± 0.001 Å |
| b |
10.9386 ± 0.0007 Å |
| c |
22.5637 ± 0.0014 Å |
| α |
90° |
| β |
90.842 ± 0.001° |
| γ |
90° |
| Cell volume |
3873.7 ± 0.4 Å3 |
| Cell temperature |
171 ± 2 K |
| Ambient diffraction temperature |
171 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0555 |
| Residual factor for significantly intense reflections |
0.0461 |
| Weighted residual factors for significantly intense reflections |
0.1307 |
| Weighted residual factors for all reflections included in the refinement |
0.1373 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.053 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1506014.html