Information card for entry 1507654
| Formula |
C11 H15 Cl N6 O2 |
| Calculated formula |
C11 H15 Cl N6 O2 |
| SMILES |
Clc1ncc(CN(/N=C/C(C)C)C(=N\N(=O)=O)\N)cc1 |
| Title of publication |
N'-Nitro-2-hydrocarbylidenehydrazinecarboximidamides: Design, Synthesis, Crystal Structure, Insecticidal Activity, and Structure-Activity Relationships. |
| Authors of publication |
Su, Wangcang; Zhou, Yihui; Ma, Yongqiang; Wang, Lei; Zhang, Zheng; Rui, Changhui; Duan, Hongxia; Qin, Zhaohai |
| Journal of publication |
Journal of agricultural and food chemistry |
| Year of publication |
2012 |
| Journal volume |
60 |
| Journal issue |
20 |
| Pages of publication |
5028 - 5034 |
| a |
8.738 ± 0.002 Å |
| b |
17.846 ± 0.004 Å |
| c |
9.701 ± 0.003 Å |
| α |
90° |
| β |
114.164 ± 0.004° |
| γ |
90° |
| Cell volume |
1380.2 ± 0.6 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0583 |
| Residual factor for significantly intense reflections |
0.0521 |
| Weighted residual factors for significantly intense reflections |
0.1178 |
| Weighted residual factors for all reflections included in the refinement |
0.1221 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.105 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1507654.html