Information card for entry 1519646
| Formula |
C43 H65 Dy N2 O6 |
| Calculated formula |
C43 H65 Dy N2 O6 |
| SMILES |
[Dy]1234([n]5ccccc5c5[n]1cccc5)(OC(=CC(=[O]2)C(C)(C)C)C(C)(C)C)(OC(=CC(=[O]3)C(C)(C)C)C(C)(C)C)OC(=CC(=[O]4)C(C)(C)C)C(C)(C)C |
| Title of publication |
Does the thermal evolution of molecular structures critically affect the magnetic anisotropy? |
| Authors of publication |
Qian, Kang; Baldoví, José J.; Jiang, Shang-Da; Gaita-Ariño, Alejandro; Zhang, Yi-Quan; Overgaard, Jacob; Wang, Bing-Wu; Coronado, Eugenio; Gao, Song |
| Journal of publication |
Chem. Sci. |
| Year of publication |
2015 |
| Journal volume |
6 |
| Journal issue |
8 |
| Pages of publication |
4587 |
| a |
11.0141 ± 0.0005 Å |
| b |
12.2286 ± 0.0005 Å |
| c |
17.5325 ± 0.0007 Å |
| α |
77.161 ± 0.004° |
| β |
85.753 ± 0.003° |
| γ |
69.723 ± 0.004° |
| Cell volume |
2159.67 ± 0.17 Å3 |
| Cell temperature |
100 ± 1 K |
| Ambient diffraction temperature |
100 ± 1 K |
| Number of distinct elements |
5 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.041 |
| Residual factor for significantly intense reflections |
0.0359 |
| Weighted residual factors for significantly intense reflections |
0.0809 |
| Weighted residual factors for all reflections included in the refinement |
0.0842 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1519646.html