Information card for entry 1544487
| Formula |
C20 H32 O10 |
| Calculated formula |
C20 H32 O10 |
| SMILES |
O1[C@H]2C[C@H]([C@]1(O)[C@@H](O)[C@@H]1[C@H](OC(=O)C1=C)[C@@H](OC(=O)/C(=C\C)C)[C@@](O)(C2)C)C.O.O |
| Title of publication |
Isolation, Structure Elucidation, and Absolute Configuration of Highly Oxygenated Germacranolides from Carpesium cernuum. |
| Authors of publication |
Liu, Qing-Xin; Yang, Yong-Xun; Zhang, Jian-Ping; Chen, Li-Ping; Shen, Yun-Heng; Li, Hui-Liang; Zhang, Wei-Dong |
| Journal of publication |
Journal of natural products |
| Year of publication |
2016 |
| Journal volume |
79 |
| Journal issue |
10 |
| Pages of publication |
2479 - 2486 |
| a |
10.3232 ± 0.0002 Å |
| b |
11.0194 ± 0.0002 Å |
| c |
19.2565 ± 0.0003 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2190.53 ± 0.07 Å3 |
| Cell temperature |
130 K |
| Ambient diffraction temperature |
130 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0337 |
| Residual factor for significantly intense reflections |
0.0329 |
| Weighted residual factors for significantly intense reflections |
0.0855 |
| Weighted residual factors for all reflections included in the refinement |
0.0861 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.085 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1544487.html