Information card for entry 1544579
| Chemical name |
(4'-Phenyl-2,2':6',2''-terpyridine-κ^3^<i>N</i>,<i>N</i>',<i>N</i>'')bis(thiocyanato-κ<i>N</i>)zinc(II) unknown solvate |
| Formula |
C23 H15 N5 S2 Zn |
| Calculated formula |
C23 H15 N5 S2 Zn |
| SMILES |
[Zn]12([n]3c(c4[n]1c(cc(c1ccccc1)c4)c1[n]2cccc1)cccc3)(N=C=S)N=C=S |
| Title of publication |
(4'-Phenyl-2,2':6',2''-terpyridine-κ^3^<i>N</i>,<i>N</i>',<i>N</i>'')bis(thiocyanato-κ<i>N</i>)zinc(II) unknown solvate |
| Authors of publication |
Wang, An-ran; Wang, Cong; Li, Sheng-Li |
| Journal of publication |
IUCrData |
| Year of publication |
2016 |
| Journal volume |
1 |
| Journal issue |
11 |
| Pages of publication |
x161758 |
| a |
11.518 ± 0.005 Å |
| b |
25.095 ± 0.005 Å |
| c |
23.137 ± 0.005 Å |
| α |
90° |
| β |
98.217 ± 0.005° |
| γ |
90° |
| Cell volume |
6619 ± 3 Å3 |
| Cell temperature |
298 ± 2 K |
| Ambient diffraction temperature |
298 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1614 |
| Residual factor for significantly intense reflections |
0.0797 |
| Weighted residual factors for significantly intense reflections |
0.1821 |
| Weighted residual factors for all reflections included in the refinement |
0.2133 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.98 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1544579.html