Information card for entry 1545015
| Chemical name |
<i>trans</i>-Diaquabis(1,1,1,5,5,5-hexafluoro-2,4-pentanedionato-κ<i>O</i>^2^,κ<i>O</i>^4^)cobalt(II) dihydrate |
| Formula |
C10 H10 Co F12 O8 |
| Calculated formula |
C10 H10 Co F12 O8 |
| SMILES |
[Co]12(OC(=CC(=[O]2)C(F)(F)F)C(F)(F)F)(OC(=CC(=[O]1)C(F)(F)F)C(F)(F)F)([OH2])[OH2].O.O |
| Title of publication |
<i>trans</i>-Diaquabis(1,1,1,5,5,5-hexafluoropentane-2,4-dionato-κ^2^<i>O</i>,<i>O</i>')cobalt(II) dihydrate |
| Authors of publication |
Tominaga, Takumi; Mochida, Tomoyuki |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
1 |
| Pages of publication |
x170002 |
| a |
11.139 ± 0.007 Å |
| b |
6.979 ± 0.004 Å |
| c |
12.546 ± 0.008 Å |
| α |
90° |
| β |
102.221 ± 0.007° |
| γ |
90° |
| Cell volume |
953.2 ± 1 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.033 |
| Residual factor for significantly intense reflections |
0.0298 |
| Weighted residual factors for significantly intense reflections |
0.0773 |
| Weighted residual factors for all reflections included in the refinement |
0.0795 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.087 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1545015.html