Information card for entry 1545481
| Chemical name |
Ethyl (<i>E</i>)-2-(2,7-dimethyl-5-oxo-4<i>H</i>,5<i>H</i>-pyrano[4,3-<i>b</i>]pyran-4-ylidene)acetate |
| Formula |
C14 H14 O5 |
| Calculated formula |
C14 H14 O5 |
| SMILES |
CCOC(=O)/C=C1/c2c(OC(=C1)C)cc(C)oc2=O |
| Title of publication |
Ethyl (<i>E</i>)-2-(2,7-dimethyl-5-oxo-4<i>H</i>,5<i>H</i>-pyrano[4,3-<i>b</i>]pyran-4-ylidene)acetate |
| Authors of publication |
Bassou, Oulemda; Chicha, Hakima; Bouissane, Latifa; Rakib, El Mostapha; Saadi, Mohamed; El Ammari, Lahcen |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
2 |
| Pages of publication |
x170208 |
| a |
9.5679 ± 0.0012 Å |
| b |
11.433 ± 0.0013 Å |
| c |
12.7993 ± 0.0015 Å |
| α |
90° |
| β |
108.257 ± 0.004° |
| γ |
90° |
| Cell volume |
1329.6 ± 0.3 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0762 |
| Residual factor for significantly intense reflections |
0.0432 |
| Weighted residual factors for significantly intense reflections |
0.1183 |
| Weighted residual factors for all reflections included in the refinement |
0.137 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.029 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1545481.html