Information card for entry 1545496
| Chemical name |
(<i>Z</i>)-2-(4-Methoxyanilino)-1,4-diphenylbut-2-ene-1,4-dione |
| Formula |
C23 H19 N O3 |
| Calculated formula |
C23 H19 N O3 |
| SMILES |
O=C(/C=C(\Nc1ccc(OC)cc1)C(=O)c1ccccc1)c1ccccc1 |
| Title of publication |
(<i>Z</i>)-2-(4-Methoxyanilino)-1,4-diphenylbut-2-ene-1,4-dione |
| Authors of publication |
Ravi, A. J.; Vinduvahini, M.; Vinayaka, A. C.; Sadashiva, M. P.; Devarajegowda, H. C. |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
2 |
| Pages of publication |
x170043 |
| a |
10.1567 ± 0.0005 Å |
| b |
8.5396 ± 0.0004 Å |
| c |
21.8019 ± 0.001 Å |
| α |
90° |
| β |
99.329 ± 0.002° |
| γ |
90° |
| Cell volume |
1865.96 ± 0.15 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0529 |
| Residual factor for significantly intense reflections |
0.0502 |
| Weighted residual factors for significantly intense reflections |
0.147 |
| Weighted residual factors for all reflections included in the refinement |
0.1506 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.061 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1545496.html