Information card for entry 1546667
| Chemical name |
(4<i>Z</i>)-4-(2-Oxopropylidene)-1,3-bis(prop-2-en-1-yl)-2,3,4,5-tetrahydro-1<i>H</i>-1,5-benzodiazepin-2-one |
| Formula |
C18 H20 N2 O2 |
| Calculated formula |
C18 H20 N2 O2 |
| SMILES |
O=C1N(c2ccccc2NC(=C\C(=O)C)/C1CC=C)CC=C |
| Title of publication |
(4<i>Z</i>)-4-(2-Oxopropylidene)-1,3-bis(prop-2-en-1-yl)-2,3,4,5-tetrahydro-1<i>H</i>-1,5-benzodiazepin-2-one |
| Authors of publication |
Sebhaoui, Jihad; El Bakri, Youness; Rayni, Ibtissam; El Bourakadi, Khadija; Essassi, El Mokhtar; Mague, Joel T. |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
4 |
| Pages of publication |
x170493 |
| a |
8.6864 ± 0.0006 Å |
| b |
8.9925 ± 0.0006 Å |
| c |
10.9872 ± 0.0007 Å |
| α |
110.653 ± 0.001° |
| β |
95.111 ± 0.001° |
| γ |
104.723 ± 0.001° |
| Cell volume |
761.42 ± 0.09 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0541 |
| Residual factor for significantly intense reflections |
0.0447 |
| Weighted residual factors for significantly intense reflections |
0.1235 |
| Weighted residual factors for all reflections included in the refinement |
0.1282 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.086 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546667.html