Information card for entry 1546676
| Common name |
Dodecaallylhexasilacyclohexane |
| Chemical name |
1,1,2,2,3,3,4,4,5,5,6,6-Dodecaallylhexasilinane |
| Formula |
C36 H60 Si6 |
| Calculated formula |
C36 H60 Si6 |
| SMILES |
[Si]1([Si]([Si]([Si]([Si]([Si]1(CC=C)CC=C)(CC=C)CC=C)(CC=C)CC=C)(CC=C)CC=C)(CC=C)CC=C)(CC=C)CC=C |
| Title of publication |
Dodecaallylhexasilacyclohexane |
| Authors of publication |
Mizuhata, Yoshiyuki; Omatsu, Yamato; Tokitoh, Norihiro |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
6 |
| Pages of publication |
x170807 |
| a |
9.6036 ± 0.0002 Å |
| b |
10.806 ± 0.0003 Å |
| c |
11.4686 ± 0.0003 Å |
| α |
108.617 ± 0.002° |
| β |
100.558 ± 0.002° |
| γ |
109.477 ± 0.0012° |
| Cell volume |
1005.91 ± 0.05 Å3 |
| Cell temperature |
103 ± 2 K |
| Ambient diffraction temperature |
103 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0347 |
| Residual factor for significantly intense reflections |
0.0324 |
| Weighted residual factors for significantly intense reflections |
0.0869 |
| Weighted residual factors for all reflections included in the refinement |
0.0886 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546676.html