Information card for entry 1546686
| Chemical name |
5,6-Dimethyl-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(prop-2-en-1-yl)-1<i>H</i>-1,3-benzodiazole |
| Formula |
C17 H19 N3 O |
| Calculated formula |
C17 H19 N3 O |
| SMILES |
o1nc(Cc2nc3c(n2CC=C)cc(c(c3)C)C)cc1C |
| Title of publication |
5,6-Dimethyl-2-[(5-methyl-1,2-oxazol-3-yl)methyl]-1-(prop-2-en-1-yl)-1<i>H</i>-1,3-benzodiazole |
| Authors of publication |
Benyahya, Mohamed Ali; El Azzaoui, Brahim; Sebbar, Nada Kheira; Ouzidan, Younes; Essassi, El Mokhtar; Mague, Joel T. |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
7 |
| Pages of publication |
x170647 |
| a |
19.6067 ± 0.0006 Å |
| b |
5.5438 ± 0.0002 Å |
| c |
14.0069 ± 0.0005 Å |
| α |
90° |
| β |
99.911 ± 0.002° |
| γ |
90° |
| Cell volume |
1499.77 ± 0.09 Å3 |
| Cell temperature |
150 ± 2 K |
| Ambient diffraction temperature |
150 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0674 |
| Residual factor for significantly intense reflections |
0.0465 |
| Weighted residual factors for significantly intense reflections |
0.1003 |
| Weighted residual factors for all reflections included in the refinement |
0.1112 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.052 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546686.html