Information card for entry 1546723
| Chemical name |
6-Amino-3,4-dimethyl-1,2,4-triazin-1-ium 2-anilinobenzoate–3-amino-5,6-dimethyl-1,2,4-triazine (1/1) |
| Formula |
C23 H27 N9 O2 |
| Calculated formula |
C23 H27 N9 O2 |
| SMILES |
[O-]C(=O)c1ccccc1Nc1ccccc1.n1[nH+]c(N)nc(c1C)C.n1nc(N)nc(c1C)C |
| Title of publication |
6-Amino-3,4-dimethyl-1,2,4-triazin-1-ium 2-anilinobenzoate–3-amino-5,6-dimethyl-1,2,4-triazine (1/1) |
| Authors of publication |
Sangeetha, Ramalingam; Balasubramani, Kasthuri; Thanigaimani, Kaliyaperumal; Razak, Ibrahim Abdul |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
6 |
| Pages of publication |
x170829 |
| a |
7.5018 ± 0.0003 Å |
| b |
7.6661 ± 0.0003 Å |
| c |
21.4332 ± 0.0009 Å |
| α |
93.743 ± 0.001° |
| β |
94.776 ± 0.001° |
| γ |
106.197 ± 0.001° |
| Cell volume |
1174.52 ± 0.08 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0628 |
| Residual factor for significantly intense reflections |
0.0452 |
| Weighted residual factors for significantly intense reflections |
0.1222 |
| Weighted residual factors for all reflections included in the refinement |
0.1329 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546723.html