Information card for entry 1546729
| Chemical name |
(1<i>R</i>,2<i>R</i>,7<i>S</i>,8<i>R</i>,9<i>R</i>)-<i>N</i>-(2-Hydroxy-2,6,6,9-tetramethyl-12-oxatricyclo[7.2.1.0^1,7^]dodecan-8-yl)acetamide |
| Formula |
C17 H29 N O3 |
| Calculated formula |
C17 H29 N O3 |
| SMILES |
[C@@]123[C@@](CCCC([C@@H]1[C@@H]([C@@](CC2)(C)O3)NC(=O)C)(C)C)(C)O |
| Title of publication |
(1<i>R</i>,2<i>R</i>,7<i>S</i>,8<i>R</i>,9<i>R</i>)-<i>N</i>-(2-Hydroxy-2,6,6,9-tetramethyl-12-oxatricyclo[7.2.1.0^1,7^]dodecan-8-yl)acetamide |
| Authors of publication |
Benharref, Amed; Ait Elhad, Mustapha; Mazoir, Noureddine; Daran, Jean-Claude; Oukhrib, Abdelouahd; Berraho, Moha |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
7 |
| Pages of publication |
x170970 |
| a |
14.5077 ± 0.001 Å |
| b |
7.9149 ± 0.0004 Å |
| c |
14.8297 ± 0.0008 Å |
| α |
90° |
| β |
106.803 ± 0.007° |
| γ |
90° |
| Cell volume |
1630.15 ± 0.18 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0938 |
| Residual factor for significantly intense reflections |
0.0552 |
| Weighted residual factors for significantly intense reflections |
0.1022 |
| Weighted residual factors for all reflections included in the refinement |
0.1145 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.99 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546729.html