Information card for entry 1546747
| Chemical name |
2,2-Difluoro-3-(4-fluorophenyl)-2<i>H</i>-benzo[<i>e</i>][1,3,2]oxazaborinin-3-ium-2-uide |
| Formula |
C13 H9 B F3 N O |
| Calculated formula |
C13 H9 B F3 N O |
| SMILES |
[B]1([N](=Cc2c(O1)cccc2)c1ccc(F)cc1)(F)F |
| Title of publication |
2,2-Difluoro-3-(4-fluorophenyl)-2<i>H</i>-benzo[<i>e</i>][1,3,2]oxazaborinin-3-ium-2-uide |
| Authors of publication |
Dziuk, Błażej; Ośmiałowski, Borys; Zakrzewska, Anna; Ejsmont, Krzysztof; Zarychta, Bartosz |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
8 |
| Pages of publication |
x171109 |
| a |
16.4374 ± 0.0009 Å |
| b |
6.2657 ± 0.0002 Å |
| c |
12.5689 ± 0.0006 Å |
| α |
90° |
| β |
120.523 ± 0.007° |
| γ |
90° |
| Cell volume |
1115.11 ± 0.12 Å3 |
| Cell temperature |
100 ± 0.1 K |
| Ambient diffraction temperature |
100 ± 0.1 K |
| Number of distinct elements |
6 |
| Space group number |
9 |
| Hermann-Mauguin space group symbol |
C 1 c 1 |
| Hall space group symbol |
C -2yc |
| Residual factor for all reflections |
0.029 |
| Residual factor for significantly intense reflections |
0.027 |
| Weighted residual factors for significantly intense reflections |
0.0673 |
| Weighted residual factors for all reflections included in the refinement |
0.0681 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.014 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1546747.html