Information card for entry 1548670
| Chemical name |
Ethyl 1-phenyl-1,4-dihydroindeno[1,2-<i>c</i>]pyrazole-3-carboxylate |
| Formula |
C19 H16 N2 O2 |
| Calculated formula |
C19 H16 N2 O2 |
| SMILES |
O=C(OCC)c1nn(c2c3c(Cc12)cccc3)c1ccccc1 |
| Title of publication |
Ethyl 1-phenyl-1,4-dihydroindeno[1,2-<i>c</i>]pyrazole-3-carboxylate |
| Authors of publication |
El-Hiti, Gamal A.; Mohamed, Hanan A.; Abdel-Wahab, Bakr F.; Alotaibi, Mohammad Hayal; Hegazy, Amany S.; Kariuki, Benson M. |
| Journal of publication |
IUCrData |
| Year of publication |
2018 |
| Journal volume |
3 |
| Journal issue |
1 |
| Pages of publication |
x171840 |
| a |
32.387 ± 0.003 Å |
| b |
9.8559 ± 0.0015 Å |
| c |
5.0043 ± 0.0008 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1597.4 ± 0.4 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
33 |
| Hermann-Mauguin space group symbol |
P n a 21 |
| Hall space group symbol |
P 2c -2n |
| Residual factor for all reflections |
0.0764 |
| Residual factor for significantly intense reflections |
0.0545 |
| Weighted residual factors for significantly intense reflections |
0.1369 |
| Weighted residual factors for all reflections included in the refinement |
0.1493 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.046 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1548670.html