Information card for entry 1548799
| Chemical name |
1-[5-Methyl-1-(4-methylphenyl)-1<i>H</i>-1,2,3-triazol-4-yl]ethanone |
| Formula |
C12 H13 N3 O |
| Calculated formula |
C12 H13 N3 O |
| SMILES |
Cc1ccc(cc1)n1c(C)c(C(=O)C)nn1 |
| Title of publication |
1-[5-Methyl-1-(4-methylphenyl)-1<i>H</i>-1,2,3-triazol-4-yl]ethanone |
| Authors of publication |
El-Hiti, Gamal A.; Abdel-Wahab, Bakr F.; Alotaibi, Mohammad Hayal; Hegazy, Amany S.; Kariuki, Benson M. |
| Journal of publication |
IUCrData |
| Year of publication |
2017 |
| Journal volume |
2 |
| Journal issue |
12 |
| Pages of publication |
x171782 |
| a |
5.7747 ± 0.0004 Å |
| b |
6.5171 ± 0.0005 Å |
| c |
30.234 ± 0.002 Å |
| α |
90° |
| β |
95.342 ± 0.007° |
| γ |
90° |
| Cell volume |
1132.89 ± 0.14 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0876 |
| Residual factor for significantly intense reflections |
0.0598 |
| Weighted residual factors for significantly intense reflections |
0.1337 |
| Weighted residual factors for all reflections included in the refinement |
0.1523 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.067 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1548799.html