Information card for entry 1549982
| Chemical name |
Ethyl 2-(5-methyl-1,2,4-triazolo[1,5-<i>a</i>]pyrimidin-7-yl)pent-4-enoate |
| Formula |
C13 H16 N4 O2 |
| Calculated formula |
C13 H16 N4 O2 |
| SMILES |
O=C(OCC)C(c1n2ncnc2nc(C)c1)CC=C |
| Title of publication |
Ethyl 2-(5-methyl-1,2,4-triazolo[1,5-<i>a</i>]pyrimidin-7-yl)pent-4-enoate |
| Authors of publication |
Lahmidi, Sanae; El Hafi, Mohamed; Moussaif, Ahmed; Benchidmi, Mohammed; Essassi, El Mokhtar; Mague, Joel T. |
| Journal of publication |
IUCrData |
| Year of publication |
2018 |
| Journal volume |
3 |
| Journal issue |
9 |
| Pages of publication |
x181280 |
| a |
9.069 ± 0.005 Å |
| b |
13.319 ± 0.007 Å |
| c |
11.851 ± 0.007 Å |
| α |
90° |
| β |
112.161 ± 0.007° |
| γ |
90° |
| Cell volume |
1325.7 ± 1.3 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.047 |
| Residual factor for significantly intense reflections |
0.0386 |
| Weighted residual factors for significantly intense reflections |
0.1109 |
| Weighted residual factors for all reflections included in the refinement |
0.1152 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.134 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1549982.html