Information card for entry 1550211
| Formula |
C23 H26 B F2 N O4 |
| Calculated formula |
C23 H26 B F2 N O4 |
| SMILES |
F[B]1(F)OC(=CC(=[O]1)c1ccc(cc1)C(=O)N[C@H](CCCC)C)c1ccc(OC)cc1 |
| Title of publication |
Mechano-responsive circularly polarized luminescence of organic solid-state chiral emitters |
| Authors of publication |
Louis, Marine; Sethy, Ramarani; Kumar, Jatish; Katao, Shouhei; Guillot, Régis; Nakashima, Takuya; Allain, Clémence; Kawai, Tsuyoshi; Métivier, Rémi |
| Journal of publication |
Chemical Science |
| Year of publication |
2019 |
| a |
10.235 ± 0.002 Å |
| b |
10.796 ± 0.002 Å |
| c |
20.224 ± 0.005 Å |
| α |
92.916 ± 0.007° |
| β |
103.825 ± 0.007° |
| γ |
90.9 ± 0.006° |
| Cell volume |
2166.2 ± 0.8 Å3 |
| Cell temperature |
123 K |
| Ambient diffraction temperature |
123 K |
| Number of distinct elements |
6 |
| Space group number |
1 |
| Hermann-Mauguin space group symbol |
P 1 |
| Hall space group symbol |
P 1 |
| Residual factor for all reflections |
0.2796 |
| Residual factor for significantly intense reflections |
0.1338 |
| Weighted residual factors for significantly intense reflections |
0.3003 |
| Weighted residual factors for all reflections included in the refinement |
0.3931 |
| Goodness-of-fit parameter for all reflections included in the refinement |
0.956 |
| Diffraction radiation wavelength |
0.71075 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1550211.html
