Information card for entry 1550628
| Chemical name |
3-[5-Methyl-1-(4-methylphenyl)-1<i>H</i>-1,2,3-triazol-4-yl]-1-phenyl-1<i>H</i>-pyrazole-4-carbaldehyde |
| Formula |
C20 H17 N5 O |
| Calculated formula |
C20 H17 N5 O |
| SMILES |
Cc1ccc(cc1)n1c(c(c2c(cn(c3ccccc3)n2)C=O)nn1)C |
| Title of publication |
3-[5-Methyl-1-(4-methylphenyl)-1<i>H</i>-1,2,3-triazol-4-yl]-1-phenyl-1<i>H</i>-pyrazole-4-carbaldehyde |
| Authors of publication |
El-Hiti, Gamal A.; Abdel-Wahab, Bakr F.; Alqahtani, Alaa; Hegazy, Amany S.; Kariuki, Benson M. |
| Journal of publication |
IUCrData |
| Year of publication |
2019 |
| Journal volume |
4 |
| Journal issue |
2 |
| Pages of publication |
x190217 |
| a |
9.7894 ± 0.0007 Å |
| b |
10.983 ± 0.0006 Å |
| c |
17.2596 ± 0.0008 Å |
| α |
93.49 ± 0.004° |
| β |
95.702 ± 0.005° |
| γ |
107.729 ± 0.006° |
| Cell volume |
1750.67 ± 0.19 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1244 |
| Residual factor for significantly intense reflections |
0.0647 |
| Weighted residual factors for significantly intense reflections |
0.1441 |
| Weighted residual factors for all reflections included in the refinement |
0.1862 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.018 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1550628.html