Information card for entry 1550658
| Formula |
C20 H20 F6 N P |
| Calculated formula |
C20 H20 F6 N P |
| SMILES |
[P](F)(F)(F)(F)(F)[F-].c12C([n+]3c(c1cccc2)cccc3)(/C=C/C(=C)C)C1CC1 |
| Title of publication |
Rhodium(III)-Catalyzed Diverse [4+1] Annulation of Arenes with 1,3-Enynes via sp3/sp2 C-H Activation and 1,4-Rhodium Migration |
| Authors of publication |
Bai, Da-Chang; xia, jintao; song, fangfang; li, xueyan; Liu, Bingxian; liu, lihong; zheng, guangfan; Yang, Xifa; Sun, Jiaqiong; Li, Xingwei |
| Journal of publication |
Chemical Science |
| Year of publication |
2019 |
| a |
8.9088 ± 0.0001 Å |
| b |
16.7762 ± 0.0003 Å |
| c |
13.3993 ± 0.0002 Å |
| α |
90° |
| β |
101.004 ± 0.001° |
| γ |
90° |
| Cell volume |
1965.78 ± 0.05 Å3 |
| Cell temperature |
296.6 ± 0.4 K |
| Ambient diffraction temperature |
296.6 ± 0.4 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0801 |
| Residual factor for significantly intense reflections |
0.072 |
| Weighted residual factors for significantly intense reflections |
0.2065 |
| Weighted residual factors for all reflections included in the refinement |
0.2163 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.06 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1550658.html