Information card for entry 1552104
| Chemical name |
Ethyl 4-(4-chloro-3-fluorophenyl)-6-methyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Formula |
C14 H14 Cl F N2 O2 S |
| Calculated formula |
C14 H14 Cl F N2 O2 S |
| SMILES |
S=C1NC(c2cc(F)c(Cl)cc2)C(=C(N1)C)C(=O)OCC |
| Title of publication |
Ethyl 4-(4-chloro-3-fluorophenyl)-6-methyl-2-sulfanylidene-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Authors of publication |
Shraddha, K. N.; Devika, S.; Begum, Noor Shahina |
| Journal of publication |
IUCrData |
| Year of publication |
2019 |
| Journal volume |
4 |
| Journal issue |
7 |
| Pages of publication |
x190960 |
| a |
7.2599 ± 0.0005 Å |
| b |
9.4979 ± 0.0007 Å |
| c |
11.9596 ± 0.0008 Å |
| α |
106.149 ± 0.002° |
| β |
90.236 ± 0.002° |
| γ |
108.939 ± 0.002° |
| Cell volume |
745.18 ± 0.09 Å3 |
| Cell temperature |
446 ± 2 K |
| Ambient diffraction temperature |
446 ± 2 K |
| Number of distinct elements |
7 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0727 |
| Residual factor for significantly intense reflections |
0.0543 |
| Weighted residual factors for significantly intense reflections |
0.1492 |
| Weighted residual factors for all reflections included in the refinement |
0.158 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.03 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1552104.html