Information card for entry 1552151
| Formula |
C48 H45 B N2 |
| Calculated formula |
C48 H45 B N2 |
| SMILES |
N(c1ccc(N(c2ccccc2)c2ccccc2)cc1)(c1ccc(cc1)B(c1c(cc(cc1C)C)C)c1c(cc(cc1C)C)C)c1ccccc1 |
| Title of publication |
A “simple” donor–acceptor AIEgen with multi-stimuli responsive behavior |
| Authors of publication |
Zhang, Jing; Li, Aisen; Zou, Hang; Peng, Junhui; Guo, Jiali; Wu, Wenjie; Zhang, Haoke; Zhang, Jun; Gu, Xinggui; Xu, Weiqing; Xu, Shuping; Liu, Sheng Hua; Qin, Anjun; Lam, Jacky W. Y.; Tang, Ben Zhong |
| Journal of publication |
Materials Horizons |
| Year of publication |
2020 |
| Journal volume |
7 |
| Journal issue |
1 |
| Pages of publication |
135 - 142 |
| a |
7.5979 ± 0.0002 Å |
| b |
32.4387 ± 0.0006 Å |
| c |
16.8075 ± 0.0004 Å |
| α |
90° |
| β |
115.761 ± 0.002° |
| γ |
90° |
| Cell volume |
3730.78 ± 0.16 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.0755 |
| Residual factor for significantly intense reflections |
0.0592 |
| Weighted residual factors for significantly intense reflections |
0.1532 |
| Weighted residual factors for all reflections included in the refinement |
0.1638 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.068 |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1552151.html