Information card for entry 1552329
| Formula |
C16 H16 Cl F N2 O3 Pt S |
| Calculated formula |
C16 H16 Cl F N2 O3 Pt S |
| SMILES |
[Pt]1([N](N=C(O1)c1ccccc1)=Cc1cc(F)ccc1O)(Cl)[S](=O)(C)C |
| Title of publication |
Novel Pt(II) complexes with modified aroyl-hydrazone Schiff-base ligands: synthesis, cytotoxicity and action mechanism |
| Authors of publication |
Deng, Jungang; Yu, Ping; zhang, zhenlei; zhang, juzheng; Zhewen, Sun; Cai, Meiling; Yuan, Haoliang; Liang, Hong; Yang, Feng |
| Journal of publication |
Metallomics |
| Year of publication |
2019 |
| a |
5.8117 ± 0.0017 Å |
| b |
10.739 ± 0.003 Å |
| c |
14.832 ± 0.004 Å |
| α |
74.851 ± 0.004° |
| β |
79.576 ± 0.004° |
| γ |
87.129 ± 0.004° |
| Cell volume |
878.8 ± 0.4 Å3 |
| Cell temperature |
296.15 K |
| Ambient diffraction temperature |
296.15 K |
| Number of distinct elements |
8 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0193 |
| Residual factor for significantly intense reflections |
0.0177 |
| Weighted residual factors for significantly intense reflections |
0.0435 |
| Weighted residual factors for all reflections included in the refinement |
0.0443 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.045 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1552329.html
