Information card for entry 1554302
| Formula |
C15 H19 N O3 S |
| Calculated formula |
C15 H19 N O3 S |
| SMILES |
S1C(=O)[C@](NC(=O)c2ccccc2)([C@@H](O)C1)CC(C)C.S1C(=O)[C@@](NC(=O)c2ccccc2)([C@H](O)C1)CC(C)C |
| Title of publication |
Organocatalytic asymmetric [3 + 2] annulation of 1,4-dithiane-2,5-diol with azlactones: access to chiral dihydrothiophen-2(3H)-one derivatives |
| Authors of publication |
Yu, Ji-cong; Yu, Le-mao; Zhao, Xiao-yun; Gan, Lu; Zhu, Wei-wei; Wang, Ze-chen; Wang, Rui; Jiang, Xianxing |
| Journal of publication |
Organic Chemistry Frontiers |
| Year of publication |
2018 |
| Journal volume |
5 |
| Journal issue |
13 |
| Pages of publication |
2040 |
| a |
10.0093 ± 0.0002 Å |
| b |
14.3918 ± 0.0003 Å |
| c |
10.7208 ± 0.0002 Å |
| α |
90° |
| β |
104.176 ± 0.002° |
| γ |
90° |
| Cell volume |
1497.32 ± 0.05 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.031 |
| Residual factor for significantly intense reflections |
0.0297 |
| Weighted residual factors for significantly intense reflections |
0.0746 |
| Weighted residual factors for all reflections included in the refinement |
0.0756 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.037 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54184 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1554302.html