Information card for entry 1554355
| Formula |
C20 H32 O5 |
| Calculated formula |
C20 H32 O5 |
| SMILES |
OC[C@]1([C@@H]2[C@@]([C@@H]3C[C@H]4C(=C)[C@@H](O)[C@]3(C(=O)C2)[C@H](O)C4)(C)CCC1)C.O |
| Title of publication |
Structurally diverse diterpenoids from Isodon pharicus |
| Authors of publication |
Hu, Zheng-Xi; Xu, Hou-Chao; Hu, Kun; Liu, Miao; Li, Xiao-Nian; Li, Xing-Ren; Du, Xue; Zhang, Yong-Hui; Puno, Pema-Tenzin; Sun, Han-Dong |
| Journal of publication |
Organic Chemistry Frontiers |
| Year of publication |
2018 |
| Journal volume |
5 |
| Journal issue |
15 |
| Pages of publication |
2379 |
| a |
6.6084 ± 0.0001 Å |
| b |
11.8396 ± 0.0002 Å |
| c |
22.9114 ± 0.0004 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
1792.61 ± 0.05 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0305 |
| Residual factor for significantly intense reflections |
0.0305 |
| Weighted residual factors for significantly intense reflections |
0.0772 |
| Weighted residual factors for all reflections included in the refinement |
0.0772 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.131 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1554355.html