Information card for entry 1554384
| Formula |
C46 H58 Mg N4 |
| Calculated formula |
C46 H58 Mg N4 |
| SMILES |
[N]1(=C(C=C(N(c2c(C(C)C)cccc2C(C)C)[Mg]21[N](=C(C=C(N2c1ccccc1)C)C)c1c(cccc1C(C)C)C(C)C)C)C)c1ccccc1 |
| Title of publication |
Unsymmetrical β-diketiminate magnesium(i) complexes: syntheses and application in catalytic hydroboration of alkyne, nitrile and carbonyl compounds |
| Authors of publication |
Li, Jia; Luo, Man; Sheng, Xingchao; Hua, Haiming; Yao, Weiwei; Pullarkat, Sumod A.; Xu, Li; Ma, Mengtao |
| Journal of publication |
Organic Chemistry Frontiers |
| Year of publication |
2018 |
| Journal volume |
5 |
| Journal issue |
24 |
| Pages of publication |
3538 |
| a |
11.0139 ± 0.0012 Å |
| b |
11.3202 ± 0.0012 Å |
| c |
18.565 ± 0.002 Å |
| α |
75.316 ± 0.003° |
| β |
83.401 ± 0.003° |
| γ |
62.905 ± 0.003° |
| Cell volume |
1993.3 ± 0.4 Å3 |
| Cell temperature |
140 ± 2 K |
| Ambient diffraction temperature |
140 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1505 |
| Residual factor for significantly intense reflections |
0.0747 |
| Weighted residual factors for significantly intense reflections |
0.1632 |
| Weighted residual factors for all reflections included in the refinement |
0.1991 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.028 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1554384.html
