Information card for entry 1556637
| Chemical name |
1,1,3,3-Tetraethyl-5-nitroisoindoline |
| Formula |
C16 H24 N2 O2 |
| Calculated formula |
C16 H24 N2 O2 |
| SMILES |
C1(NC(CC)(CC)c2cc(ccc12)N(=O)=O)(CC)CC |
| Title of publication |
1,1,3,3-Tetraethyl-5-nitroisoindoline |
| Authors of publication |
Tapmeyer, Lukas; Beske, Maurice; Plackmeyer, Jörn |
| Journal of publication |
IUCrData |
| Year of publication |
2019 |
| Journal volume |
4 |
| Journal issue |
12 |
| Pages of publication |
x191629 |
| a |
9.0277 ± 0.0006 Å |
| b |
19.9356 ± 0.0013 Å |
| c |
9.4811 ± 0.0007 Å |
| α |
90° |
| β |
116.169 ± 0.002° |
| γ |
90° |
| Cell volume |
1531.43 ± 0.18 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.052 |
| Residual factor for significantly intense reflections |
0.0512 |
| Weighted residual factors for significantly intense reflections |
0.1336 |
| Weighted residual factors for all reflections included in the refinement |
0.1344 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.086 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1556637.html