Information card for entry 1556857
| Formula |
C32 H54 O4 |
| Calculated formula |
C32 H54 O4 |
| SMILES |
CC(C)[C@]1(CO)OC[C@@H]([C@@H]2[C@@]3(C)CCC4=C(CC[C@H]5C(C)(C)[C@@H](O)CC[C@]45C)C3=C(C)C2)CC1.OC |
| Title of publication |
Antcamphorols A‒K, Cytotoxic and ROS Scavenging Triterpenoids from Antrodia camphorata |
| Authors of publication |
Li, Bin; Kuang, Yi; He, Jun-Bin; Tang, Rui; Xu, Lu-Lu; Leung, Chung-Hang; Ma, Dik-Lung; Qiao, Xue; Ye, Min |
| Journal of publication |
Journal of Natural Products |
| Year of publication |
2019 |
| a |
6.2668 ± 0.0008 Å |
| b |
14.648 ± 0.003 Å |
| c |
31.434 ± 0.005 Å |
| α |
90° |
| β |
90° |
| γ |
90° |
| Cell volume |
2885.5 ± 0.8 Å3 |
| Cell temperature |
106.7 K |
| Ambient diffraction temperature |
106.7 K |
| Number of distinct elements |
3 |
| Space group number |
19 |
| Hermann-Mauguin space group symbol |
P 21 21 21 |
| Hall space group symbol |
P 2ac 2ab |
| Residual factor for all reflections |
0.0523 |
| Residual factor for significantly intense reflections |
0.0463 |
| Weighted residual factors for significantly intense reflections |
0.1114 |
| Weighted residual factors for all reflections included in the refinement |
0.1159 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.042 |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
Yes |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1556857.html