Information card for entry 1556898
| Chemical name |
Diethyl 4-(3-chlorophenyl)-2,6-diphenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Formula |
C29 H26 Cl N O4 |
| Calculated formula |
C29 H26 Cl N O4 |
| SMILES |
c1ccccc1C1=C(C(=O)OCC)C(c2cccc(c2)Cl)C(=C(c2ccccc2)N1)C(=O)OCC |
| Title of publication |
Diethyl 4-(3-chlorophenyl)-2,6-diphenyl-1,4-dihydropyridine-3,5-dicarboxylate |
| Authors of publication |
Ameen, K. K. Mohammed; Ahamed, F. M. Mashood; Padusha, M. Syed Ali; Gunasekaran, B. |
| Journal of publication |
IUCrData |
| Year of publication |
2019 |
| Journal volume |
4 |
| Journal issue |
12 |
| Pages of publication |
x191644 |
| a |
10.519 ± 0.005 Å |
| b |
22.059 ± 0.005 Å |
| c |
11.246 ± 0.005 Å |
| α |
90 ± 0.005° |
| β |
97.867 ± 0.005° |
| γ |
90 ± 0.005° |
| Cell volume |
2584.9 ± 1.8 Å3 |
| Cell temperature |
295 ± 2 K |
| Ambient diffraction temperature |
295 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.1133 |
| Residual factor for significantly intense reflections |
0.0604 |
| Weighted residual factors for significantly intense reflections |
0.1619 |
| Weighted residual factors for all reflections included in the refinement |
0.1919 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1556898.html