Information card for entry 1557138
| Formula |
C19 H30 O3 |
| Calculated formula |
C19 H30 O3 |
| SMILES |
O[C@]1([C@@H]2CC(=O)C3=C(CC[C@](CCO)(C3)C)[C@@]2(C)CCC1)C |
| Title of publication |
Immunosuppressive Nor-isopimarane Diterpenes from Cultures of the Fungicolous Fungus <i>Xylaria longipes</i> HFG1018. |
| Authors of publication |
Chen, He-Ping; Zhao, Zhen-Zhu; Cheng, Gui-Guang; Zhao, Kuan; Han, Kai-Yue; Zhou, Lin; Feng, Tao; Li, Zheng-Hui; Liu, Ji-Kai |
| Journal of publication |
Journal of natural products |
| Year of publication |
2020 |
| a |
8.4484 ± 0.0002 Å |
| b |
22.6578 ± 0.0004 Å |
| c |
17.8169 ± 0.0003 Å |
| α |
90° |
| β |
90.006 ± 0.001° |
| γ |
90° |
| Cell volume |
3410.55 ± 0.12 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0324 |
| Residual factor for significantly intense reflections |
0.0322 |
| Weighted residual factors for significantly intense reflections |
0.0876 |
| Weighted residual factors for all reflections included in the refinement |
0.0882 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.055 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1557138.html