Information card for entry 1557593
| Common name |
(±)-(2SR,3RS) |
| Formula |
C16 H15 N O3 S |
| Calculated formula |
C16 N O3 S |
| SMILES |
S1[C@H]([C@H](O)C(=O)Nc2c1cccc2)c1ccc(OC)cc1.S1[C@@H]([C@@H](O)C(=O)Nc2c1cccc2)c1ccc(OC)cc1 |
| Title of publication |
Enantiomer Associations in the Crystal Structures of Racemic and (2S,3R)-(-)-3-Hydroxy-2-(4-methoxyphenyl)-2,3-dihydro-1,5- benzothiazepin-4(5H)-one |
| Authors of publication |
Marthi, Karalin; Larsen, Sine; Acs, Maria; Jaszay, Zsuzsa; Fogassy, Elemer |
| Journal of publication |
Acta Chemica Scandinavica |
| Year of publication |
1996 |
| Journal volume |
50 |
| Pages of publication |
906 - 913 |
| a |
13.308 ± 0.003 Å |
| b |
4.8474 ± 0.0008 Å |
| c |
22.13 ± 0.004 Å |
| α |
90° |
| β |
91.782 ± 0.014° |
| γ |
90° |
| Cell volume |
1426.9 ± 0.5 Å3 |
| Ambient diffraction temperature |
122 K |
| Number of distinct elements |
5 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for significantly intense reflections |
0.032 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.5418 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1557593.html