Information card for entry 1558573
| Common name |
1,2,4,5,7,8-Hexachloronaphthalene |
| Formula |
C10 H2 Cl6 |
| Calculated formula |
C10 Cl6 |
| SMILES |
Clc1cc(Cl)c(Cl)c2c(Cl)c(Cl)cc(Cl)c12 |
| Title of publication |
Synthesis and Crystallography of Two Hexachloronaphthalenes. Part II. 1,2,4,5,6,8-Hexachloronaphthalene and 1,2,4,5,7,8-Hexachloronaphthalene |
| Authors of publication |
Jakobsson, Eva; Lonnberg, Cecilia; Eriksson, Lars |
| Journal of publication |
Acta Chemica Scandinavica |
| Year of publication |
1994 |
| Journal volume |
48 |
| Pages of publication |
891 - 898 |
| a |
18.553 ± 0.013 Å |
| b |
3.882 ± 0.002 Å |
| c |
31.55 ± 0.02 Å |
| α |
90° |
| β |
94.74 ± 0.05° |
| γ |
90° |
| Cell volume |
2265 ± 2 Å3 |
| Ambient diffraction temperature |
293 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/a 1 |
| Hall space group symbol |
-P 2yab |
| Residual factor for all reflections |
0.1273 |
| Residual factor for significantly intense reflections |
0.0751 |
| Weighted residual factors for all reflections included in the refinement |
0.2426 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.435 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1558573.html