Information card for entry 1558675
| Formula |
C12 H8 O2 S |
| Calculated formula |
C12 H8 O2 S |
| SMILES |
c12ccccc1c1c(S2(=O)=O)cccc1 |
| Title of publication |
Structure-activity relationships in well-defined conjugated oligomer photocatalysts for hydrogen production from water |
| Authors of publication |
Aitchison, Catherine M.; Sachs, Michael; Little, Marc; Wilbraham, Liam; Brownbill, Nick J.; Kane, Chris; Blanc, Frédéric; Zwijnenburg, Martijn; Durrant, James; Sprick, Reiner Sebastian; Cooper, Andrew |
| Journal of publication |
Chemical Science |
| Year of publication |
2020 |
| a |
10.1221 ± 0.0008 Å |
| b |
13.8377 ± 0.0011 Å |
| c |
7.1345 ± 0.0005 Å |
| α |
90° |
| β |
91.65 ± 0.002° |
| γ |
90° |
| Cell volume |
998.89 ± 0.13 Å3 |
| Cell temperature |
298 K |
| Ambient diffraction temperature |
298 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.0518 |
| Residual factor for significantly intense reflections |
0.0454 |
| Weighted residual factors for significantly intense reflections |
0.1333 |
| Weighted residual factors for all reflections included in the refinement |
0.1401 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.088 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1558675.html