Information card for entry 1558679
| Formula |
C24 H14 O4 S2 |
| Calculated formula |
C24 H14 O4 S2 |
| SMILES |
O=S1(=O)c2ccccc2c2c1cc(cc2)c1ccc2c3c(S(=O)(=O)c2c1)cccc3 |
| Title of publication |
Structure-activity relationships in well-defined conjugated oligomer photocatalysts for hydrogen production from water |
| Authors of publication |
Aitchison, Catherine M.; Sachs, Michael; Little, Marc; Wilbraham, Liam; Brownbill, Nick J.; Kane, Chris; Blanc, Frédéric; Zwijnenburg, Martijn; Durrant, James; Sprick, Reiner Sebastian; Cooper, Andrew |
| Journal of publication |
Chemical Science |
| Year of publication |
2020 |
| a |
7.3833 ± 0.0013 Å |
| b |
8.4946 ± 0.0016 Å |
| c |
15.02 ± 0.003 Å |
| α |
94.371 ± 0.005° |
| β |
93.59 ± 0.006° |
| γ |
90.853 ± 0.005° |
| Cell volume |
937.3 ± 0.3 Å3 |
| Cell temperature |
298 K |
| Ambient diffraction temperature |
298 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.1041 |
| Residual factor for significantly intense reflections |
0.0653 |
| Weighted residual factors for significantly intense reflections |
0.1639 |
| Weighted residual factors for all reflections included in the refinement |
0.1804 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.057 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1558679.html