Information card for entry 1558916
| Formula |
C17 H22 O6 |
| Calculated formula |
C17 H22 O6 |
| SMILES |
O(C(=O)C)[C@H]1/C=C(/C[C@@H]2OC(=O)C(=C)[C@H]2C[C@H](OO)C(=C)C1)C |
| Title of publication |
Artemyrianolides A–S, Cytotoxic Sesquiterpenoids from Artemisia myriantha |
| Authors of publication |
Tang, Shuang; Zhang, Xin-Tian; Ma, Yun-Bao; Huang, Xiao-Yan; Geng, Chang-An; Li, Tian-Ze; Zhang, Xue-Mei; Shen, Cheng; Su, Li-Hua; Gao, Zhen; Chen, Ji-Jun |
| Journal of publication |
Journal of Natural Products |
| Year of publication |
2020 |
| a |
7.3771 ± 0.0002 Å |
| b |
12.8589 ± 0.0003 Å |
| c |
8.6273 ± 0.0002 Å |
| α |
90° |
| β |
91.272 ± 0.001° |
| γ |
90° |
| Cell volume |
818.2 ± 0.03 Å3 |
| Cell temperature |
100 ± 2 K |
| Ambient diffraction temperature |
100 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for all reflections |
0.0256 |
| Residual factor for significantly intense reflections |
0.0255 |
| Weighted residual factors for significantly intense reflections |
0.0656 |
| Weighted residual factors for all reflections included in the refinement |
0.0657 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.062 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1558916.html