Information card for entry 1559187
| Formula |
C21 H22.5 N2 O |
| Calculated formula |
C21 H22 N2 O |
| SMILES |
Oc1c2nc(/C=C/c3ccc(N(CC)CC)cc3)ccc2ccc1 |
| Title of publication |
A multi-photon fluorescent probe based on quinoline groups for highly selective and sensitive detection of lipid droplets |
| Authors of publication |
Zhang, Sijing; Yang, Zhenghui; LI, Minghao; Zhang, Qiong; Tian, Xiaohe; Li, Dandan; Li, Shengli; Wu, Jieying; Tian, Yupeng |
| Journal of publication |
The Analyst |
| Year of publication |
2020 |
| a |
11.151 ± 0.002 Å |
| b |
12.493 ± 0.003 Å |
| c |
15.327 ± 0.003 Å |
| α |
104.622 ± 0.002° |
| β |
101.56 ± 0.002° |
| γ |
114.181 ± 0.002° |
| Cell volume |
1769.6 ± 0.6 Å3 |
| Cell temperature |
296 ± 2 K |
| Ambient diffraction temperature |
296.15 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0732 |
| Residual factor for significantly intense reflections |
0.0566 |
| Weighted residual factors for significantly intense reflections |
0.158 |
| Weighted residual factors for all reflections included in the refinement |
0.1757 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.044 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1559187.html
