Information card for entry 1559930
| Common name |
N,N'-bis(4-methoxybenzylidene) Ethylenediamine |
| Chemical name |
(E,E)-N,N'-1,2-Ethanediylbis[1-(4-methoxyphenyl)methanimine] |
| Formula |
C18 H20 N2 O2 |
| Calculated formula |
C18 H20 N2 O2 |
| SMILES |
C(=N\CC/N=C/c1ccc(cc1)OC)/c1ccc(cc1)OC |
| Title of publication |
Synthesis, Spectroscopic Studies and Crystal Structures of N,N'-bis(4-methoxybenzylidene) Ethylenediamine and its New Cadmium(II) Complex |
| Authors of publication |
Ndiolene, Adrienne; Diop, Tidiane; Sembene Boye, Mouhamadou; Maris, Thierry; Diasse-Sar, Aminata |
| Journal of publication |
American Journal Of Heterocyclic Chemistry |
| Year of publication |
2020 |
| Journal volume |
6 |
| Pages of publication |
30 - 35 |
| a |
9.9522 ± 0.0005 Å |
| b |
7.8338 ± 0.0004 Å |
| c |
10.6286 ± 0.0005 Å |
| α |
90° |
| β |
110.972 ± 0.002° |
| γ |
90° |
| Cell volume |
773.75 ± 0.07 Å3 |
| Cell temperature |
100 K |
| Ambient diffraction temperature |
100 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.0448 |
| Residual factor for significantly intense reflections |
0.0425 |
| Weighted residual factors for significantly intense reflections |
0.1156 |
| Weighted residual factors for all reflections included in the refinement |
0.1186 |
| Goodness-of-fit parameter for all reflections included in the refinement |
1.07 |
| Diffraction radiation probe |
x-ray |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
Yes |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/1559930.html