Information card for entry 2000418
| Chemical name |
5'-O-acetyl-4'-cyano-2',3'-didehydro-2',3'-dideoxyuridine |
| Formula |
C12 H11 N3 O5 |
| Calculated formula |
C12 H11 N3 O5 |
| SMILES |
N#C[C@@]1(COC(=O)C)C=C[C@@H](O1)N1C=CC(NC1=O)=O |
| Title of publication |
Structure of a 4'-<i>C</i>-branched 2',3'-didehydro-2',3'-dideoxyuridine |
| Authors of publication |
Yamaguchi, K.; Haraguchi, K.; Tanaka, H.; Itoh, Y.; Miyasaka, T. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1992 |
| Journal volume |
48 |
| Journal issue |
12 |
| Pages of publication |
2277 - 2278 |
| a |
14.87 ± 0.001 Å |
| b |
5.411 ± 0.001 Å |
| c |
8.15 ± 0.001 Å |
| α |
90° |
| β |
95.71 ± 0.02° |
| γ |
90° |
| Cell volume |
652.51 ± 0.15 Å3 |
| Cell temperature |
297 K |
| Number of distinct elements |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Residual factor for significantly intense reflections |
0.047 |
| Weighted residual factors for significantly intense reflections |
0.046 |
| Goodness-of-fit parameter for significantly intense reflections |
3.04 |
| Diffraction radiation wavelength |
1.5405 Å |
| Diffraction radiation type |
CuKα~1~ |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2000418.html