Information card for entry 2001342
| Chemical name |
3-cyano-4-(3-methoxyphenyl)-1,1-diphenyl-2-aza-1,3-butadiene |
| Formula |
C23 H18 N2 O |
| Calculated formula |
C23 H18 N2 O |
| SMILES |
N#CC(=C/c1cccc(c1)OC)/N=C(c1ccccc1)c1ccccc1 |
| Title of publication |
Structures of 1,1-diphenyl-2-aza-1,3-butadienes. I. 3-Cyano-4-(<i>n</i>-methoxyphenyl)-1,1-diphenyl-2-aza-1,3-butadienes (<i>n</i> = 2, 3, 4) |
| Authors of publication |
Angelova, O.; Macíček, J.; Dryanska, V. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1993 |
| Journal volume |
49 |
| Journal issue |
10 |
| Pages of publication |
1813 - 1818 |
| a |
10.216 ± 0.001 Å |
| b |
7.706 ± 0.001 Å |
| c |
23.933 ± 0.003 Å |
| α |
90° |
| β |
100.13 ± 0.01° |
| γ |
90° |
| Cell volume |
1854.7 ± 0.4 Å3 |
| Cell temperature |
292 K |
| Ambient diffraction temperature |
292 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for significantly intense reflections |
0.043 |
| Weighted residual factors for significantly intense reflections |
0.056 |
| Goodness-of-fit parameter for significantly intense reflections |
1.606 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2001342.html