Information card for entry 2002011
| Formula |
C31 H25 N3 P2 |
| Calculated formula |
C31 H25 N3 P2 |
| SMILES |
c1ccc(cc1)C1=NP(=NP(=N1)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
| Title of publication |
Structure of 2,2,4,4,6-pentaphenyl-2,4,1,3,5-diphosphatriazine; a six-membered P~2~N~3~C ring |
| Authors of publication |
Chandrasekhar, V.; Chivers, T.; Parvez, M. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1993 |
| Journal volume |
49 |
| Journal issue |
2 |
| Pages of publication |
393 - 394 |
| a |
15.76 ± 0.002 Å |
| b |
10.832 ± 0.002 Å |
| c |
16.611 ± 0.002 Å |
| α |
90° |
| β |
116.34 ± 0.01° |
| γ |
90° |
| Cell volume |
2541.3 ± 0.7 Å3 |
| Cell temperature |
296 K |
| Number of distinct elements |
4 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for significantly intense reflections |
0.049 |
| Weighted residual factors for significantly intense reflections |
0.04 |
| Goodness-of-fit parameter for significantly intense reflections |
1.77 |
| Diffraction radiation wavelength |
0.71093 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2002011.html
