Information card for entry 2003172
| Formula |
C54 H54 O12 |
| Calculated formula |
C54 H54 O12 |
| SMILES |
CCOC(=O)COc1c2COCc3cc(cc(c3OCC(=O)OCC)COCc3c(c(COCc1cc(c2)c1ccccc1)cc(c3)c1ccccc1)OCC(=O)OCC)c1ccccc1 |
| Title of publication |
7,15,23-Triphenyl-25,26,27-triethylester-2,3,10,11,18,19-hexahomo-3,9,11-trioxacalix[3]arene in a Partial-Cone Conformation |
| Authors of publication |
Khrifi, Saad; Guelzim, Abdelhalim; Baert, Francois; Mussrabi, Mamoun; Asfari, Zouhair; Vicens, Jacques |
| Journal of publication |
Acta Crystallographica, Section C: Crystal Structure Communications |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
1 |
| Pages of publication |
153 - 157 |
| a |
16.15 ± 0.006 Å |
| b |
16.842 ± 0.009 Å |
| c |
19.599 ± 0.007 Å |
| α |
69.02 ± 0.05° |
| β |
80.85 ± 0.04° |
| γ |
70.91 ± 0.06° |
| Cell volume |
4698 Å3 |
| Cell temperature |
293 K |
| Number of distinct elements |
3 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for significantly intense reflections |
0.059 |
| Weighted residual factors for significantly intense reflections |
0.059 |
| Diffraction radiation wavelength |
0.71063 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003172.html