Information card for entry 2003967
| Common name |
O-Methyl-THPO hydrochloride |
| Chemical name |
O-Methyl-4,5,6,7-tetrahydroisoxazolo[4,5c]pyridin-3-ol hydrochloride |
| Formula |
C7 H11 Cl N2 O2 |
| Calculated formula |
C7 H11 Cl N2 O2 |
| SMILES |
[Cl-].o1nc(c2c1CC[NH2+]C2)OC |
| Title of publication |
<i>O</i>-Methyl-4,5,6,7-tetrahydroisoxazolo[4,5-<i>c</i>]pyridin-3-ol Hydrochloride, <i>O</i>-Me-THPO.HCl |
| Authors of publication |
Frydenvang, K.; Hansen, L. M.; Jensen, B. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
10 |
| Pages of publication |
2053 - 2057 |
| a |
19.746 ± 0.005 Å |
| b |
12.403 ± 0.003 Å |
| c |
7.254 ± 0.002 Å |
| α |
90° |
| β |
100.57 ± 0.02° |
| γ |
90° |
| Cell volume |
1746.4 ± 0.8 Å3 |
| Cell temperature |
122 ± 2 K |
| Ambient diffraction temperature |
122 ± 2 K |
| Number of distinct elements |
5 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for all reflections |
0.1088 |
| Residual factor for significantly intense reflections |
0.05 |
| Weighted residual factors for all reflections |
0.1559 |
| Weighted residual factors for significantly intense reflections |
0.1239 |
| Goodness-of-fit parameter for all reflections |
1.068 |
| Goodness-of-fit parameter for significantly intense reflections |
1.083 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003967.html