Information card for entry 2003994
| Formula |
C11 H11 N3 S2 |
| Calculated formula |
C11 H11 N3 S2 |
| SMILES |
CN1N=C(CC(=S)NC1=S)c1ccccc1 |
| Title of publication |
2-Méthyl-7-phényl-3,5-dithioxo-3,4,5,6-tétrahydro-2<i>H</i>-1,2,4-triazépine |
| Authors of publication |
Toledano, P.; Ait Itto, M. Y.; Hasnaoui, A. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
10 |
| Pages of publication |
2066 - 2068 |
| a |
24.122 ± 0.003 Å |
| b |
13.321 ± 0.002 Å |
| c |
7.509 ± 0.001 Å |
| α |
90° |
| β |
101.6 ± 0.01° |
| γ |
90° |
| Cell volume |
2363.6 ± 0.6 Å3 |
| Cell temperature |
293 K |
| Number of distinct elements |
4 |
| Space group number |
15 |
| Hermann-Mauguin space group symbol |
C 1 2/c 1 |
| Hall space group symbol |
-C 2yc |
| Residual factor for significantly intense reflections |
0.0327 |
| Weighted residual factors for significantly intense reflections |
0.0317 |
| Goodness-of-fit parameter for significantly intense reflections |
3.73 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2003994.html