Information card for entry 2004269
| Chemical name |
cis-1,5-diamino-2,4,6,8-tetraazabicyclo[3.3.0]octan3,7-dione |
| Formula |
C4 H8 N6 O2 |
| Calculated formula |
C4 H8 N6 O2 |
| SMILES |
[C@]12([C@](NC(=O)N1)(N)NC(=O)N2)N |
| Title of publication |
<i>cis</i>-1,5-Diamino-2,4,6,8-tetraazabicyclo[3.3.0]octane-3,7-dione |
| Authors of publication |
Modric, N.; Poje, M.; Vickovic, I. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1995 |
| Journal volume |
51 |
| Journal issue |
12 |
| Pages of publication |
2594 - 2595 |
| a |
10.64 ± 0.003 Å |
| b |
10.618 ± 0.004 Å |
| c |
5.976 ± 0.002 Å |
| α |
90° |
| β |
102.86 ± 0.02° |
| γ |
90° |
| Cell volume |
658.2 ± 0.4 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/n 1 |
| Hall space group symbol |
-P 2yn |
| Residual factor for all reflections |
0.042 |
| Residual factor for significantly intense reflections |
0.042 |
| Weighted residual factors for all reflections |
0.1207 |
| Weighted residual factors for significantly intense reflections |
0.1207 |
| Goodness-of-fit parameter for all reflections |
1.289 |
| Goodness-of-fit parameter for significantly intense reflections |
1.291 |
| Diffraction radiation wavelength |
1.54178 Å |
| Diffraction radiation type |
CuKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2004269.html