Information card for entry 2004396
| Formula |
C17 H22 N2 O5 |
| Calculated formula |
C17 H22 N2 O5 |
| SMILES |
O=C(OC(C)(C)C)N[C@@H]1CCC(=O)N(C1=O)OCc1ccccc1 |
| Title of publication |
(<i>S</i>)-3-(1,1-Dimethyloxycarbonylamino)-1-phenylmethyloxypiperidine-2,6-dione, C~17~H~22~N~2~O~5~ |
| Authors of publication |
Tomas, A.; Lemoine, P.; Viossat, B.; Robin, S.; Zhu, J.; Galons, H. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1996 |
| Journal volume |
52 |
| Journal issue |
1 |
| Pages of publication |
199 - 201 |
| a |
10.26 ± 0.007 Å |
| b |
10.819 ± 0.005 Å |
| c |
16.266 ± 0.009 Å |
| α |
90° |
| β |
106.07 ± 0.07° |
| γ |
90° |
| Cell volume |
1735 ± 1.8 Å3 |
| Cell temperature |
295 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
4 |
| Hermann-Mauguin space group symbol |
P 1 21 1 |
| Hall space group symbol |
P 2yb |
| Residual factor for significantly intense reflections |
0.058 |
| Weighted residual factors for significantly intense reflections |
0.06 |
| Goodness-of-fit parameter for significantly intense reflections |
1.01 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2004396.html
