Information card for entry 2004727
| Chemical name |
2,4-dinitro-cis-1,5-dimethyl-2,4-diazabicyclo[3,1.0]hexan-3-one |
| Formula |
C6 H8 N4 O5 |
| Calculated formula |
C6 H8 N4 O5 |
| SMILES |
[C@@]12(C)N(N(=O)=O)C(=O)N(N(=O)=O)[C@]1(C)C2 |
| Title of publication |
<i>cis</i>-1,5-Dimethyl-2,4-dinitro-2,4-diazabicyclo[3.2.0]heptan-3-one and <i>cis</i>-1,5-Dimethyl-2,4-dinitro-2,4-diazabicyclo[3.1.0]hexan-3-one |
| Authors of publication |
Deschamps, J. R.; George, C.; Gilardi, R. D.; Gagnon, J. L.; Zajac, Jnr, W. W. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1996 |
| Journal volume |
52 |
| Journal issue |
4 |
| Pages of publication |
993 - 995 |
| a |
7.306 ± 0.001 Å |
| b |
10.83 ± 0.002 Å |
| c |
11.525 ± 0.002 Å |
| α |
90° |
| β |
91.3 ± 0.02° |
| γ |
90° |
| Cell volume |
911.7 ± 0.3 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1062 |
| Residual factor for significantly intense reflections |
0.0547 |
| Weighted residual factors for all reflections |
0.1526 |
| Weighted residual factors for significantly intense reflections |
0.1233 |
| Goodness-of-fit parameter for all reflections |
1.032 |
| Goodness-of-fit parameter for significantly intense reflections |
1.107 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2004727.html