Information card for entry 2004761
| Chemical name |
6,6'-Diphenyl-3,3'-bis-1,2,4,5-tetrazine |
| Formula |
C16 H10 N8 |
| Calculated formula |
C16 H10 N8 |
| SMILES |
n1nc(nnc1c1nnc(nn1)c1ccccc1)c1ccccc1 |
| Title of publication |
Arene–Arene Stacking in 6,6'-Diphenyl-3,3'-bi-1,2,4,5-tetrazine and 6-Phenyl-1,2,4,5-tetrazine-3-carbaldehyde Benzoylhydrazone Monohydrate |
| Authors of publication |
Breu, J.; Range, K.-J.; Biedermann, N.; Schmid, K.; Sauer, J. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1996 |
| Journal volume |
52 |
| Journal issue |
4 |
| Pages of publication |
936 - 940 |
| a |
14.063 ± 0.003 Å |
| b |
5.267 ± 0.0005 Å |
| c |
18.941 ± 0.003 Å |
| α |
90° |
| β |
98.387 ± 0.014° |
| γ |
90° |
| Cell volume |
1388 ± 0.4 Å3 |
| Cell temperature |
173 ± 2 K |
| Ambient diffraction temperature |
173 ± 2 K |
| Number of distinct elements |
3 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.1055 |
| Residual factor for significantly intense reflections |
0.0378 |
| Weighted residual factors for all reflections |
0.0886 |
| Weighted residual factors for significantly intense reflections |
0.0724 |
| Goodness-of-fit parameter for all reflections |
0.745 |
| Goodness-of-fit parameter for significantly intense reflections |
0.968 |
| Diffraction radiation wavelength |
0.71069 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2004761.html