Information card for entry 2005394
| Chemical name |
1-diethylaminomethyl-6,8-dimethyl-2-(4-methoxyphenyl)imidazo[1,2-a][1,8] naphthyridine. |
| Formula |
C24 H28 N4 O |
| Calculated formula |
C24 H28 N4 O |
| SMILES |
O(c1ccc(c2nc3n(c4nc(cc(c4cc3)C)C)c2CN(CC)CC)cc1)C |
| Title of publication |
Substituted Imidazonaphthyridine Derivatives. III. C~24~H~28~N~4~, C~24~H~28~N~4~O and C~23~H~25~BrN~4~ |
| Authors of publication |
Sivakumar, K.; Fun, H.-K.; Chua, S.-O.; Ooi, M.-F.; Anwair, M. A. S.; Gan, E.-K.; Jackson, W. R. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1996 |
| Journal volume |
52 |
| Journal issue |
9 |
| Pages of publication |
2239 - 2243 |
| a |
7.358 ± 0.001 Å |
| b |
10.641 ± 0.001 Å |
| c |
13.586 ± 0.001 Å |
| α |
96.55 ± 0.01° |
| β |
95.64 ± 0.01° |
| γ |
98.11 ± 0.01° |
| Cell volume |
1039.13 ± 0.19 Å3 |
| Cell temperature |
293 ± 2 K |
| Ambient diffraction temperature |
293 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
2 |
| Hermann-Mauguin space group symbol |
P -1 |
| Hall space group symbol |
-P 1 |
| Residual factor for all reflections |
0.0507 |
| Residual factor for significantly intense reflections |
0.0383 |
| Weighted residual factors for all reflections |
0.105 |
| Weighted residual factors for significantly intense reflections |
0.1001 |
| Goodness-of-fit parameter for all reflections |
0.976 |
| Goodness-of-fit parameter for significantly intense reflections |
1.09 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2005394.html