Information card for entry 2005732
| Chemical name |
2,2'-[2,2-dimethyl-1,3-propanediylbis(nitrilopropylidyne)]diphenol |
| Formula |
C23 H30 N2 O2 |
| Calculated formula |
C23 H30 N2 O2 |
| SMILES |
Oc1ccccc1C(=N\CC(C)(C)C/N=C(CC)/c1ccccc1O)\CC |
| Title of publication |
Two Schiff Base Ligands Derived from 2,2-Dimethyl-1,3-propanediamine |
| Authors of publication |
Corden, J. P.; Errington, W.; Moore, P.; Phillips, P. R.; Wallbridge, M. G. H. |
| Journal of publication |
Acta Crystallographica Section C |
| Year of publication |
1996 |
| Journal volume |
52 |
| Journal issue |
12 |
| Pages of publication |
3199 - 3202 |
| a |
12.443 ± 0.01 Å |
| b |
13.286 ± 0.009 Å |
| c |
13.093 ± 0.008 Å |
| α |
90° |
| β |
108.37 ± 0.05° |
| γ |
90° |
| Cell volume |
2054 ± 3 Å3 |
| Cell temperature |
120 ± 2 K |
| Ambient diffraction temperature |
120 ± 2 K |
| Number of distinct elements |
4 |
| Space group number |
14 |
| Hermann-Mauguin space group symbol |
P 1 21/c 1 |
| Hall space group symbol |
-P 2ybc |
| Residual factor for all reflections |
0.073 |
| Residual factor for significantly intense reflections |
0.0453 |
| Weighted residual factors for all reflections |
0.1052 |
| Weighted residual factors for significantly intense reflections |
0.0985 |
| Goodness-of-fit parameter for all reflections |
0.852 |
| Goodness-of-fit parameter for significantly intense reflections |
1.038 |
| Diffraction radiation wavelength |
0.71073 Å |
| Diffraction radiation type |
MoKα |
| Has coordinates |
Yes |
| Has disorder |
No |
| Has Fobs |
No |
For the version history of this entry, please navigate to main COD server.
The link is:
https://www.crystallography.net/2005732.html